C24H52O3Si3 — CID 132938700
[(2S,3S)-3-[(Z,1S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-enyl]oxiran-2-yl]-trimethylsilane (PubChem CID 132938700) has the molecular formula C24H52O3Si3 and a molecular weight of 472.94 g/mol. Its IUPAC name is [(2S,3S)-3-[(Z,1S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-enyl]oxiran-2-yl]-trimethylsilane.
| Compound Name | [(2S,3S)-3-[(Z,1S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-enyl]oxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 132938700 |
| Molecular Formula | C24H52O3Si3 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | [(2S,3S)-3-[(Z,1S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-enyl]oxiran-2-yl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C24H52O3Si3/c1-23(2,3)29(10,11)25-19-17-15-14-16-18-20(21-22(26-21)28(7,8)9)27-30(12,13)24(4,5)6/h14,16,20-22H,15,17-19H2,1-13H3/b16-14-/t20-,21-,22-/m0/s1 |
| InChIKey | YCJMGDKCDDJNST-ONCFDGBXSA-N |
| XLogP | 7.77 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|