C49H38N2O4S2 — CID 132938793
2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene]-2',7'-diamine (PubChem CID 132938793) has the molecular formula C49H38N2O4S2 and a molecular weight of 782.99 g/mol. Its IUPAC name is 2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene]-2',7'-diamine.
| Compound Name | 2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 132938793 |
| Molecular Formula | C49H38N2O4S2 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.23 |
| IUPAC Name | 2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene]-2',7'-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)C2(c4cc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)ccc4-3)c3ccsc3-c3sccc32)cc1 |
| InChI | InChI=1S/C49H38N2O4S2/c1-52-37-15-5-31(6-16-37)50(32-7-17-38(53-2)18-8-32)35-13-23-41-42-24-14-36(51(33-9-19-39(54-3)20-10-33)34-11-21-40(55-4)22-12-34)30-46(42)49(45(41)29-35)43-25-27-56-47(43)48-44(49)26-28-57-48/h5-30H,1-4H3 |
| InChIKey | GHJLWHZCWPAJFL-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |