C14H26O6Si — CID 132938980
methyl (1S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate (PubChem CID 132938980) has the molecular formula C14H26O6Si and a molecular weight of 318.44 g/mol. Its IUPAC name is methyl (1S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 132938980 |
| Molecular Formula | C14H26O6Si |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | methyl (1S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)C=CC(O)C(O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O6Si/c1-13(2,3)21(5,6)20-11-10(16)9(15)7-8-14(11,18)12(17)19-4/h7-11,15-16,18H,1-6H3/t9?,10?,11-,14+/m1/s1 |
| InChIKey | DJUTWAHUVPLCKO-OTFCRSJLSA-N |
| XLogP | 0.57 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|