C16H14N2O2 — CID 13293995
5-benzyl-3-phenyl-2,5-dihydro-1,2,4-oxadiazin-6-one (PubChem CID 13293995) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-benzyl-3-phenyl-2,5-dihydro-1,2,4-oxadiazin-6-one.
| Compound Name | 5-benzyl-3-phenyl-2,5-dihydro-1,2,4-oxadiazin-6-one |
|---|---|
| PubChem CID | 13293995 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-benzyl-3-phenyl-2,5-dihydro-1,2,4-oxadiazin-6-one |
| SMILES | O=C1ONC(c2ccccc2)=NC1Cc1ccccc1 |
| InChI | InChI=1S/C16H14N2O2/c19-16-14(11-12-7-3-1-4-8-12)17-15(18-20-16)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,17,18) |
| InChIKey | KELIYVXSTJQHRA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |