C12H17BrN2O2 — CID 13294000
4-bromo-N-hydroxy-N'-(1-hydroxy-3-methylbutan-2-yl)benzenecarboximidamide (PubChem CID 13294000) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 4-bromo-N-hydroxy-N'-(1-hydroxy-3-methylbutan-2-yl)benzenecarboximidamide.
| Compound Name | 4-bromo-N-hydroxy-N'-(1-hydroxy-3-methylbutan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 13294000 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 4-bromo-N-hydroxy-N'-(1-hydroxy-3-methylbutan-2-yl)benzenecarboximidamide |
| SMILES | CC(C)C(CO)/N=C(\NO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-8(2)11(7-16)14-12(15-17)9-3-5-10(13)6-4-9/h3-6,8,11,16-17H,7H2,1-2H3,(H,14,15) |
| InChIKey | ZBYUCQFEWPWDBD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|