C27H54O2Sn — CID 13294204
tributyl-[(E,1R)-1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethoxy]but-2-enyl]stannane (PubChem CID 13294204) has the molecular formula C27H54O2Sn and a molecular weight of 529.44 g/mol. Its IUPAC name is tributyl-[(E,1R)-1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethoxy]but-2-enyl]stannane.
| Compound Name | tributyl-[(E,1R)-1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethoxy]but-2-enyl]stannane |
|---|---|
| PubChem CID | 13294204 |
| Molecular Formula | C27H54O2Sn |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | tributyl-[(E,1R)-1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethoxy]but-2-enyl]stannane |
| SMILES | C/C=C/[C@H](OCO[C@@H]1C[C@H](C)CC[C@H]1C(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H27O2.3C4H9.Sn/c1-5-6-9-16-11-17-15-10-13(4)7-8-14(15)12(2)3;3*1-3-4-2;/h5-6,9,12-15H,7-8,10-11H2,1-4H3;3*1,3-4H2,2H3;/b6-5+;;;;/t13-,14+,15-;;;;/m1..../s1 |
| InChIKey | SXWKOUVRXBQNQK-WVLXNHMISA-N |
| XLogP | 8.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|