About dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane
dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane (PubChem CID 132942594) has the molecular formula C17H32N2P+
and a molecular weight of 295.43 g/mol. Its IUPAC name is dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane.
Molecular Properties
| Compound Name | dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane |
| PubChem CID | 132942594 |
| Molecular Formula | C17H32N2P+ |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane |
| SMILES | CN1CC[N+](C)=C1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H32N2P/c1-18-13-14-19(2)17(18)20(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h15-16H,3-14H2,1-2H3/q+1 |
| InChIKey | IXYAFBCLZDOAHP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane?
The IUPAC name of dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane (CID 132942594) is dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane.
What is the SMILES notation for dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane?
The canonical SMILES for dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane is CN1CC[N+](C)=C1P(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane?
The InChIKey is IXYAFBCLZDOAHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2P/c1-18-13-14-19(2)17(18)20(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h15-16H,3-14H2,1-2H3/q+1.
What are the key properties of dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane?
dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane has a molecular weight of 295.43 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)phosphane is sourced from PubChem (CID 132942594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).