C13H22O3 — CID 132942802
6,6-dibutyl-2-hydroxy-2H-pyran-5-one (PubChem CID 132942802) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 6,6-dibutyl-2-hydroxy-2H-pyran-5-one.
| Compound Name | 6,6-dibutyl-2-hydroxy-2H-pyran-5-one |
|---|---|
| PubChem CID | 132942802 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 6,6-dibutyl-2-hydroxy-2H-pyran-5-one |
| SMILES | CCCCC1(CCCC)OC(O)C=CC1=O |
| InChI | InChI=1S/C13H22O3/c1-3-5-9-13(10-6-4-2)11(14)7-8-12(15)16-13/h7-8,12,15H,3-6,9-10H2,1-2H3 |
| InChIKey | AGASFYWKZWSHMA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |