C19H16O2 — CID 132942999
3,3-dimethyl-4-phenyl-4H-indeno[1,2-c]furan-1-one (PubChem CID 132942999) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3,3-dimethyl-4-phenyl-4H-indeno[1,2-c]furan-1-one.
| Compound Name | 3,3-dimethyl-4-phenyl-4H-indeno[1,2-c]furan-1-one |
|---|---|
| PubChem CID | 132942999 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3,3-dimethyl-4-phenyl-4H-indeno[1,2-c]furan-1-one |
| SMILES | CC1(C)OC(=O)C2=C1C(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C19H16O2/c1-19(2)17-15(12-8-4-3-5-9-12)13-10-6-7-11-14(13)16(17)18(20)21-19/h3-11,15H,1-2H3 |
| InChIKey | GDAAYHQVDOXZCX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |