About tert-butyl N-hex-1-en-3-ylcarbamate
tert-butyl N-hex-1-en-3-ylcarbamate (PubChem CID 13294367) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is tert-butyl N-hex-1-en-3-ylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-hex-1-en-3-ylcarbamate |
| PubChem CID | 13294367 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | tert-butyl N-hex-1-en-3-ylcarbamate |
| SMILES | C=CC(CCC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-6-8-9(7-2)12-10(13)14-11(3,4)5/h7,9H,2,6,8H2,1,3-5H3,(H,12,13) |
| InChIKey | FTTANWBTDLVFOG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-hex-1-en-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-hex-1-en-3-ylcarbamate?
The IUPAC name of tert-butyl N-hex-1-en-3-ylcarbamate (CID 13294367) is tert-butyl N-hex-1-en-3-ylcarbamate.
What is the SMILES notation for tert-butyl N-hex-1-en-3-ylcarbamate?
The canonical SMILES for tert-butyl N-hex-1-en-3-ylcarbamate is C=CC(CCC)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-hex-1-en-3-ylcarbamate?
The InChIKey is FTTANWBTDLVFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-6-8-9(7-2)12-10(13)14-11(3,4)5/h7,9H,2,6,8H2,1,3-5H3,(H,12,13).
What are the key properties of tert-butyl N-hex-1-en-3-ylcarbamate?
tert-butyl N-hex-1-en-3-ylcarbamate has a molecular weight of 199.29 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-hex-1-en-3-ylcarbamate is sourced from PubChem (CID 13294367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).