C28H33N3O2S — CID 132944171
(5E)-1-(4-ethylphenyl)-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione (PubChem CID 132944171) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is (5E)-1-(4-ethylphenyl)-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(4-ethylphenyl)-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 132944171 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (5E)-1-(4-ethylphenyl)-2-sulfanylidene-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3ccc4c(c3)C(C)CC(C)(C)N4C(C)C)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C28H33N3O2S/c1-7-19-8-11-21(12-9-19)30-26(33)23(25(32)29-27(30)34)15-20-10-13-24-22(14-20)18(4)16-28(5,6)31(24)17(2)3/h8-15,17-18H,7,16H2,1-6H3,(H,29,32,34)/b23-15+ |
| InChIKey | JKIVTCNNQPXNEP-HZHRSRAPSA-N |
| XLogP | 5.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|