About 2-oxo-5-phenylpentanoic acid
2-oxo-5-phenylpentanoic acid (PubChem CID 13294447) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-oxo-5-phenylpentanoic acid.
Molecular Properties
| Compound Name | 2-oxo-5-phenylpentanoic acid |
| PubChem CID | 13294447 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-oxo-5-phenylpentanoic acid |
| SMILES | O=C(O)C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C11H12O3/c12-10(11(13)14)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,13,14) |
| InChIKey | MJXXAPORLGKVLB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-5-phenylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-5-phenylpentanoic acid?
The IUPAC name of 2-oxo-5-phenylpentanoic acid (CID 13294447) is 2-oxo-5-phenylpentanoic acid.
What is the SMILES notation for 2-oxo-5-phenylpentanoic acid?
The canonical SMILES for 2-oxo-5-phenylpentanoic acid is O=C(O)C(=O)CCCc1ccccc1.
What is the InChIKey of 2-oxo-5-phenylpentanoic acid?
The InChIKey is MJXXAPORLGKVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c12-10(11(13)14)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,13,14).
What are the key properties of 2-oxo-5-phenylpentanoic acid?
2-oxo-5-phenylpentanoic acid has a molecular weight of 192.21 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-5-phenylpentanoic acid is sourced from PubChem (CID 13294447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).