C6H20Cl2N2O6P2 — CID 13294663
bis(2-chloroethylphosphonic acid);1,1-dimethylhydrazine (PubChem CID 13294663) has the molecular formula C6H20Cl2N2O6P2 and a molecular weight of 349.09 g/mol. Its IUPAC name is bis(2-chloroethylphosphonic acid);1,1-dimethylhydrazine.
| Compound Name | bis(2-chloroethylphosphonic acid);1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 13294663 |
| Molecular Formula | C6H20Cl2N2O6P2 |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | bis(2-chloroethylphosphonic acid);1,1-dimethylhydrazine |
| SMILES | CN(C)N.O=P(O)(O)CCCl.O=P(O)(O)CCCl |
| InChI | InChI=1S/2C2H6ClO3P.C2H8N2/c2*3-1-2-7(4,5)6;1-4(2)3/h2*1-2H2,(H2,4,5,6);3H2,1-2H3 |
| InChIKey | QSKVOYFLUVGXCS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|