About 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one
1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one (PubChem CID 13294670) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one |
| PubChem CID | 13294670 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one |
| SMILES | CCN1C(=O)CCc2c(O)cccc21 |
| InChI | InChI=1S/C11H13NO2/c1-2-12-9-4-3-5-10(13)8(9)6-7-11(12)14/h3-5,13H,2,6-7H2,1H3 |
| InChIKey | RLMKVSQXWVJYEO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one?
The IUPAC name of 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one (CID 13294670) is 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one?
The canonical SMILES for 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one is CCN1C(=O)CCc2c(O)cccc21.
What is the InChIKey of 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one?
The InChIKey is RLMKVSQXWVJYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-12-9-4-3-5-10(13)8(9)6-7-11(12)14/h3-5,13H,2,6-7H2,1H3.
What are the key properties of 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one?
1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one has a molecular weight of 191.23 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 13294670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).