C26H34N2O3 — CID 132947968
N-cyclohexyl-2-[[2-(4-methoxyphenyl)acetyl]-[(3-methylphenyl)methyl]amino]propanamide (PubChem CID 132947968) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-methoxyphenyl)acetyl]-[(3-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-methoxyphenyl)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132947968 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-methoxyphenyl)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(CC(=O)N(Cc2cccc(C)c2)C(C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-19-8-7-9-22(16-19)18-28(20(2)26(30)27-23-10-5-4-6-11-23)25(29)17-21-12-14-24(31-3)15-13-21/h7-9,12-16,20,23H,4-6,10-11,17-18H2,1-3H3,(H,27,30) |
| InChIKey | KFNQSUFTZOORGF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |