C19H29NO3 — CID 132948445
4-cyclobutyl-6-[(2,3,5-trimethylphenoxy)methyl]-1,4-oxazepan-6-ol (PubChem CID 132948445) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 4-cyclobutyl-6-[(2,3,5-trimethylphenoxy)methyl]-1,4-oxazepan-6-ol.
| Compound Name | 4-cyclobutyl-6-[(2,3,5-trimethylphenoxy)methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 132948445 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 4-cyclobutyl-6-[(2,3,5-trimethylphenoxy)methyl]-1,4-oxazepan-6-ol |
| SMILES | Cc1cc(C)c(C)c(OCC2(O)COCCN(C3CCC3)C2)c1 |
| InChI | InChI=1S/C19H29NO3/c1-14-9-15(2)16(3)18(10-14)23-13-19(21)11-20(7-8-22-12-19)17-5-4-6-17/h9-10,17,21H,4-8,11-13H2,1-3H3 |
| InChIKey | BLVWWXDAJWTNLB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |