About (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea
(4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea (PubChem CID 13296069) has the molecular formula C6H10N6O2
and a molecular weight of 198.19 g/mol. Its IUPAC name is (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea.
Molecular Properties
| Compound Name | (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea |
| PubChem CID | 13296069 |
| Molecular Formula | C6H10N6O2 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea |
| SMILES | CCOc1nc(N)nc(NC(N)=O)n1 |
| InChI | InChI=1S/C6H10N6O2/c1-2-14-6-10-3(7)9-5(12-6)11-4(8)13/h2H2,1H3,(H5,7,8,9,10,11,12,13) |
| InChIKey | HXTBBPRUQJQDRL-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea?
The IUPAC name of (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea (CID 13296069) is (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea.
What is the SMILES notation for (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea?
The canonical SMILES for (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea is CCOc1nc(N)nc(NC(N)=O)n1.
What is the InChIKey of (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea?
The InChIKey is HXTBBPRUQJQDRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6O2/c1-2-14-6-10-3(7)9-5(12-6)11-4(8)13/h2H2,1H3,(H5,7,8,9,10,11,12,13).
What are the key properties of (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea?
(4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea has a molecular weight of 198.19 g/mol, XLogP of -0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-6-ethoxy-1,3,5-triazin-2-yl)urea is sourced from PubChem (CID 13296069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).