About 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea
1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea (PubChem CID 1329609) has the molecular formula C27H22N6S
and a molecular weight of 462.58 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea |
| PubChem CID | 1329609 |
| Molecular Formula | C27H22N6S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc3nc(-c4ccccn4)c(-c4ccccn4)nc3c2)cc1C |
| InChI | InChI=1S/C27H22N6S/c1-17-9-10-19(15-18(17)2)30-27(34)31-20-11-12-21-24(16-20)33-26(23-8-4-6-14-29-23)25(32-21)22-7-3-5-13-28-22/h3-16H,1-2H3,(H2,30,31,34) |
| InChIKey | BGXBSWUCCSBLAW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea?
The IUPAC name of 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea (CID 1329609) is 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea.
What is the SMILES notation for 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea?
The canonical SMILES for 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea is Cc1ccc(NC(=S)Nc2ccc3nc(-c4ccccn4)c(-c4ccccn4)nc3c2)cc1C.
What is the InChIKey of 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea?
The InChIKey is BGXBSWUCCSBLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N6S/c1-17-9-10-19(15-18(17)2)30-27(34)31-20-11-12-21-24(16-20)33-26(23-8-4-6-14-29-23)25(32-21)22-7-3-5-13-28-22/h3-16H,1-2H3,(H2,30,31,34).
What are the key properties of 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea?
1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea has a molecular weight of 462.58 g/mol, XLogP of 6.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)-3-(2,3-dipyridin-2-ylquinoxalin-6-yl)thiourea is sourced from PubChem (CID 1329609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).