About N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide
N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide (PubChem CID 132961363) has the molecular formula C9H9N3O4S2
and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide |
| PubChem CID | 132961363 |
| Molecular Formula | C9H9N3O4S2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2csc(S(N)(=O)=O)c2)no1 |
| InChI | InChI=1S/C9H9N3O4S2/c1-5(13)11-8-3-7(12-16-8)6-2-9(17-4-6)18(10,14)15/h2-4H,1H3,(H,11,13)(H2,10,14,15) |
| InChIKey | OAXXTLQPXFSIMN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide?
The IUPAC name of N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide (CID 132961363) is N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide.
What is the SMILES notation for N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide?
The canonical SMILES for N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide is CC(=O)Nc1cc(-c2csc(S(N)(=O)=O)c2)no1.
What is the InChIKey of N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide?
The InChIKey is OAXXTLQPXFSIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O4S2/c1-5(13)11-8-3-7(12-16-8)6-2-9(17-4-6)18(10,14)15/h2-4H,1H3,(H,11,13)(H2,10,14,15).
What are the key properties of N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide?
N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide has a molecular weight of 287.32 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5-sulfamoylthiophen-3-yl)-1,2-oxazol-5-yl]acetamide is sourced from PubChem (CID 132961363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).