About 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide
5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide (PubChem CID 132961364) has the molecular formula C10H12N4O5S2
and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide |
| PubChem CID | 132961364 |
| Molecular Formula | C10H12N4O5S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1ccc(-c2noc(N)c2S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H12N4O5S2/c1-5-2-3-6(4-7(5)20(12,15)16)8-9(21(13,17)18)10(11)19-14-8/h2-4H,11H2,1H3,(H2,12,15,16)(H2,13,17,18) |
| InChIKey | RSIDZAKDVUGKLQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide?
The IUPAC name of 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide (CID 132961364) is 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide?
The canonical SMILES for 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide is Cc1ccc(-c2noc(N)c2S(N)(=O)=O)cc1S(N)(=O)=O.
What is the InChIKey of 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide?
The InChIKey is RSIDZAKDVUGKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O5S2/c1-5-2-3-6(4-7(5)20(12,15)16)8-9(21(13,17)18)10(11)19-14-8/h2-4H,11H2,1H3,(H2,12,15,16)(H2,13,17,18).
What are the key properties of 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide?
5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide has a molecular weight of 332.36 g/mol, XLogP of -0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(4-methyl-3-sulfamoylphenyl)-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 132961364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).