C22H19OP — CID 132961425
(1S,8S,9S)-1-methyl-8-phenyl-8λ5-phosphatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene 8-oxide (PubChem CID 132961425) has the molecular formula C22H19OP and a molecular weight of 330.37 g/mol. Its IUPAC name is (1S,8S,9S)-1-methyl-8-phenyl-8λ5-phosphatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene 8-oxide.
| Compound Name | (1S,8S,9S)-1-methyl-8-phenyl-8λ5-phosphatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene 8-oxide |
|---|---|
| PubChem CID | 132961425 |
| Molecular Formula | C22H19OP |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (1S,8S,9S)-1-methyl-8-phenyl-8λ5-phosphatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene 8-oxide |
| SMILES | C[C@]12C[C@@H](c3ccccc31)[P@](=O)(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C22H19OP/c1-22-15-21(17-11-5-6-12-18(17)22)24(23,16-9-3-2-4-10-16)20-14-8-7-13-19(20)22/h2-14,21H,15H2,1H3/t21-,22-,24-/m0/s1 |
| InChIKey | VOEDRRJOTCXCLL-FIXSFTCYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|