C13H12N4O — CID 132961491
5-phenyl-11-oxa-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4-triene (PubChem CID 132961491) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 5-phenyl-11-oxa-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4-triene.
| Compound Name | 5-phenyl-11-oxa-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4-triene |
|---|---|
| PubChem CID | 132961491 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-phenyl-11-oxa-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4-triene |
| SMILES | c1ccc(-c2nnc3n2CCC2CON=C32)cc1 |
| InChI | InChI=1S/C13H12N4O/c1-2-4-9(5-3-1)12-14-15-13-11-10(8-18-16-11)6-7-17(12)13/h1-5,10H,6-8H2 |
| InChIKey | QWMWUVTWOWXSMJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |