C19H23NO3 — CID 13296325
(4S)-4-benzyl-3-[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 13296325) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 13296325 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (4S)-4-benzyl-3-[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CC1=CC[C@H](C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H23NO3/c1-13-8-9-17(14(2)10-13)18(21)20-16(12-23-19(20)22)11-15-6-4-3-5-7-15/h3-8,14,16-17H,9-12H2,1-2H3/t14-,16-,17-/m0/s1 |
| InChIKey | WJFAREKOMAHCLP-XIRDDKMYSA-N |
| XLogP | 3.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|