C14H22ClN3O — CID 132965081
N-(3,4-dimethylphenyl)-2-piperazin-1-ylacetamide;hydrochloride (PubChem CID 132965081) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-piperazin-1-ylacetamide;hydrochloride.
| Compound Name | N-(3,4-dimethylphenyl)-2-piperazin-1-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 132965081 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-piperazin-1-ylacetamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CN2CCNCC2)cc1C.Cl |
| InChI | InChI=1S/C14H21N3O.ClH/c1-11-3-4-13(9-12(11)2)16-14(18)10-17-7-5-15-6-8-17;/h3-4,9,15H,5-8,10H2,1-2H3,(H,16,18);1H |
| InChIKey | WMJURNWINLBUQO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |