About 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol
1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol (PubChem CID 132966604) has the molecular formula C26H24N2OS
and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol.
Molecular Properties
| Compound Name | 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol |
| PubChem CID | 132966604 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol |
| SMILES | OC(CS(=Nc1ccccc1)(=Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24N2OS/c29-26(22-13-5-1-6-14-22)21-30(25-19-11-4-12-20-25,27-23-15-7-2-8-16-23)28-24-17-9-3-10-18-24/h1-20,26,29H,21H2 |
| InChIKey | UBJFEIKPHPXIEN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol?
The IUPAC name of 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol (CID 132966604) is 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol.
What is the SMILES notation for 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol?
The canonical SMILES for 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol is OC(CS(=Nc1ccccc1)(=Nc1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol?
The InChIKey is UBJFEIKPHPXIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2OS/c29-26(22-13-5-1-6-14-22)21-30(25-19-11-4-12-20-25,27-23-15-7-2-8-16-23)28-24-17-9-3-10-18-24/h1-20,26,29H,21H2.
What are the key properties of 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol?
1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol has a molecular weight of 412.56 g/mol, XLogP of 6.96, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol is sourced from PubChem (CID 132966604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).