C26H23N3O3S — CID 132966605
1-(4-nitrophenyl)-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol (PubChem CID 132966605) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol.
| Compound Name | 1-(4-nitrophenyl)-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol |
|---|---|
| PubChem CID | 132966605 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-(4-nitrophenyl)-2-(N,N',S-triphenylsulfonodiimidoyl)ethanol |
| SMILES | O=[N+]([O-])c1ccc(C(O)CS(=Nc2ccccc2)(=Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O3S/c30-26(21-16-18-24(19-17-21)29(31)32)20-33(25-14-8-3-9-15-25,27-22-10-4-1-5-11-22)28-23-12-6-2-7-13-23/h1-19,26,30H,20H2 |
| InChIKey | XOSIZWCUKORECK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|