C7H12O6 — CID 132966642
dimethyl (2S,3R)-2,3-dihydroxypentanedioate (PubChem CID 132966642) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is dimethyl (2S,3R)-2,3-dihydroxypentanedioate.
| Compound Name | dimethyl (2S,3R)-2,3-dihydroxypentanedioate |
|---|---|
| PubChem CID | 132966642 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | dimethyl (2S,3R)-2,3-dihydroxypentanedioate |
| SMILES | COC(=O)C[C@@H](O)[C@H](O)C(=O)OC |
| InChI | InChI=1S/C7H12O6/c1-12-5(9)3-4(8)6(10)7(11)13-2/h4,6,8,10H,3H2,1-2H3/t4-,6+/m1/s1 |
| InChIKey | CTIAXCOLGTVHAR-XINAWCOVSA-N |
| XLogP | -1.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |