C75H50N6 — CID 132966859
4-[2',7'-bis(1H-benzimidazol-2-yl)-7-[4-(N-phenylanilino)phenyl]-9,9'-spirobi[fluorene]-2-yl]-N,N-diphenylaniline (PubChem CID 132966859) has the molecular formula C75H50N6 and a molecular weight of 1035.27 g/mol. Its IUPAC name is 4-[2',7'-bis(1H-benzimidazol-2-yl)-7-[4-(N-phenylanilino)phenyl]-9,9'-spirobi[fluorene]-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[2',7'-bis(1H-benzimidazol-2-yl)-7-[4-(N-phenylanilino)phenyl]-9,9'-spirobi[fluorene]-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 132966859 |
| Molecular Formula | C75H50N6 |
| Molecular Weight | 1035.27 g/mol |
| Exact Mass | 1034.41 |
| IUPAC Name | 4-[2',7'-bis(1H-benzimidazol-2-yl)-7-[4-(N-phenylanilino)phenyl]-9,9'-spirobi[fluorene]-2-yl]-N,N-diphenylaniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc(-c3ccc4c(c3)C3(c5cc(-c6ccc(N(c7ccccc7)c7ccccc7)cc6)ccc5-4)c4cc(-c5nc6ccccc6[nH]5)ccc4-c4ccc(-c5nc6ccccc6[nH]5)cc43)cc2)cc1 |
| InChI | InChI=1S/C75H50N6/c1-5-17-55(18-6-1)80(56-19-7-2-8-20-56)59-37-29-49(30-38-59)51-33-41-61-62-42-34-52(50-31-39-60(40-32-50)81(57-21-9-3-10-22-57)58-23-11-4-12-24-58)46-66(62)75(65(61)45-51)67-47-53(73-76-69-25-13-14-26-70(69)77-73)35-43-63(67)64-44-36-54(48-68(64)75)74-78-71-27-15-16-28-72(71)79-74/h1-48H,(H,76,77)(H,78,79) |
| InChIKey | PXNMHWZTSPOFHR-UHFFFAOYSA-N |
| XLogP | 19.39 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.27 |
| LogP ≤ 5 | 19.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |