(E)-4-oxopent-2-enoyl chloride

C5H5ClO2 — CID 13296686

IUPAC(E)-4-oxopent-2-enoyl chloride
SMILESCC(=O)/C=C/C(=O)Cl
InChIInChI=1S/C5H5ClO2/c1-4(7)2-3-5(6)8/h2-3H,1H3/b3-2+
InChIKeyGOKUKIRFOQPVFI-NSCUHMNNSA-N
MW132.55 g/mol
LogP0.90
Rot. Bonds2

About (E)-4-oxopent-2-enoyl chloride

(E)-4-oxopent-2-enoyl chloride (PubChem CID 13296686) has the molecular formula C5H5ClO2 and a molecular weight of 132.55 g/mol. Its IUPAC name is (E)-4-oxopent-2-enoyl chloride.

Molecular Properties

Compound Name(E)-4-oxopent-2-enoyl chloride
PubChem CID13296686
Molecular FormulaC5H5ClO2
Molecular Weight132.55 g/mol
Exact Mass132.00
IUPAC Name(E)-4-oxopent-2-enoyl chloride
SMILESCC(=O)/C=C/C(=O)Cl
InChIInChI=1S/C5H5ClO2/c1-4(7)2-3-5(6)8/h2-3H,1H3/b3-2+
InChIKeyGOKUKIRFOQPVFI-NSCUHMNNSA-N
XLogP0.90
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.55
LogP ≤ 50.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-oxopent-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-oxopent-2-enoyl chloride?
The IUPAC name of (E)-4-oxopent-2-enoyl chloride (CID 13296686) is (E)-4-oxopent-2-enoyl chloride.
What is the SMILES notation for (E)-4-oxopent-2-enoyl chloride?
The canonical SMILES for (E)-4-oxopent-2-enoyl chloride is CC(=O)/C=C/C(=O)Cl.
What is the InChIKey of (E)-4-oxopent-2-enoyl chloride?
The InChIKey is GOKUKIRFOQPVFI-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H5ClO2/c1-4(7)2-3-5(6)8/h2-3H,1H3/b3-2+.
What are the key properties of (E)-4-oxopent-2-enoyl chloride?
(E)-4-oxopent-2-enoyl chloride has a molecular weight of 132.55 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-oxopent-2-enoyl chloride is sourced from PubChem (CID 13296686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).