C18H29FOSi — CID 132967113
tert-butyl-[(1R,2S)-2-(4-fluorophenyl)cyclohexyl]oxy-dimethylsilane (PubChem CID 132967113) has the molecular formula C18H29FOSi and a molecular weight of 308.51 g/mol. Its IUPAC name is tert-butyl-[(1R,2S)-2-(4-fluorophenyl)cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S)-2-(4-fluorophenyl)cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 132967113 |
| Molecular Formula | C18H29FOSi |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | tert-butyl-[(1R,2S)-2-(4-fluorophenyl)cyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H29FOSi/c1-18(2,3)21(4,5)20-17-9-7-6-8-16(17)14-10-12-15(19)13-11-14/h10-13,16-17H,6-9H2,1-5H3/t16-,17+/m0/s1 |
| InChIKey | PPQUFIGQSPMVMC-DLBZAZTESA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|