About tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane
tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane (PubChem CID 132967116) has the molecular formula C19H32O2Si
and a molecular weight of 320.55 g/mol. Its IUPAC name is tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane |
| PubChem CID | 132967116 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane |
| SMILES | COc1cccc([C@@H]2CCCC[C@H]2O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32O2Si/c1-19(2,3)22(5,6)21-18-13-8-7-12-17(18)15-10-9-11-16(14-15)20-4/h9-11,14,17-18H,7-8,12-13H2,1-6H3/t17-,18+/m0/s1 |
| InChIKey | HVMQPWDQAHQANG-ZWKOTPCHSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane (CID 132967116) is tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane is COc1cccc([C@@H]2CCCC[C@H]2O[Si](C)(C)C(C)(C)C)c1.
What is the InChIKey of tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane?
The InChIKey is HVMQPWDQAHQANG-ZWKOTPCHSA-N. The full InChI is InChI=1S/C19H32O2Si/c1-19(2,3)22(5,6)21-18-13-8-7-12-17(18)15-10-9-11-16(14-15)20-4/h9-11,14,17-18H,7-8,12-13H2,1-6H3/t17-,18+/m0/s1.
What are the key properties of tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane?
tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane has a molecular weight of 320.55 g/mol, XLogP of 5.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1R,2S)-2-(3-methoxyphenyl)cyclohexyl]oxy-dimethylsilane is sourced from PubChem (CID 132967116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).