C11H18O3 — CID 132967417
(3S,6E,8E)-1-hydroxy-3-methoxydeca-6,8-dien-5-one (PubChem CID 132967417) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3S,6E,8E)-1-hydroxy-3-methoxydeca-6,8-dien-5-one.
| Compound Name | (3S,6E,8E)-1-hydroxy-3-methoxydeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 132967417 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3S,6E,8E)-1-hydroxy-3-methoxydeca-6,8-dien-5-one |
| SMILES | C/C=C/C=C/C(=O)C[C@H](CCO)OC |
| InChI | InChI=1S/C11H18O3/c1-3-4-5-6-10(13)9-11(14-2)7-8-12/h3-6,11-12H,7-9H2,1-2H3/b4-3+,6-5+/t11-/m0/s1 |
| InChIKey | SFRGJAXQGRXKMD-KXGOJYIESA-N |
| XLogP | 1.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|