C20H30O5 — CID 132967419
(3S,6E,8E)-3-hydroxy-1-[(6E,8E)-1-hydroxy-5-oxodeca-6,8-dien-3-yl]oxydeca-6,8-dien-5-one (PubChem CID 132967419) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3S,6E,8E)-3-hydroxy-1-[(6E,8E)-1-hydroxy-5-oxodeca-6,8-dien-3-yl]oxydeca-6,8-dien-5-one.
| Compound Name | (3S,6E,8E)-3-hydroxy-1-[(6E,8E)-1-hydroxy-5-oxodeca-6,8-dien-3-yl]oxydeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 132967419 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (3S,6E,8E)-3-hydroxy-1-[(6E,8E)-1-hydroxy-5-oxodeca-6,8-dien-3-yl]oxydeca-6,8-dien-5-one |
| SMILES | C/C=C/C=C/C(=O)CC(CCO)OCC[C@H](O)CC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C20H30O5/c1-3-5-7-9-17(22)15-19(24)12-14-25-20(11-13-21)16-18(23)10-8-6-4-2/h3-10,19-21,24H,11-16H2,1-2H3/b5-3+,6-4+,9-7+,10-8+/t19-,20?/m0/s1 |
| InChIKey | ZSCYVHXHBMERNH-PVDKQDNHSA-N |
| XLogP | 2.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|