C20H34O5 — CID 132967420
(E,3S)-3-hydroxy-1-[(2R,4S)-4-hydroxy-2-[(E)-pent-3-enyl]oxan-2-yl]oxydec-8-en-5-one (PubChem CID 132967420) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (E,3S)-3-hydroxy-1-[(2R,4S)-4-hydroxy-2-[(E)-pent-3-enyl]oxan-2-yl]oxydec-8-en-5-one.
| Compound Name | (E,3S)-3-hydroxy-1-[(2R,4S)-4-hydroxy-2-[(E)-pent-3-enyl]oxan-2-yl]oxydec-8-en-5-one |
|---|---|
| PubChem CID | 132967420 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (E,3S)-3-hydroxy-1-[(2R,4S)-4-hydroxy-2-[(E)-pent-3-enyl]oxan-2-yl]oxydec-8-en-5-one |
| SMILES | C/C=C/CCC(=O)C[C@@H](O)CCO[C@]1(CC/C=C/C)C[C@@H](O)CCO1 |
| InChI | InChI=1S/C20H34O5/c1-3-5-7-9-17(21)15-18(22)10-13-24-20(12-8-6-4-2)16-19(23)11-14-25-20/h3-6,18-19,22-23H,7-16H2,1-2H3/b5-3+,6-4+/t18-,19-,20-/m0/s1 |
| InChIKey | SRMFPPPFRLKNNH-UQJYPGNUSA-N |
| XLogP | 3.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|