C31H62O9 — CID 132967543
[(8R,19S,20R,23S,24R)-26-[(2R)-2,3-dihydroxypropoxy]-19,20,23,24-tetrahydroxyhexacosan-8-yl] acetate (PubChem CID 132967543) has the molecular formula C31H62O9 and a molecular weight of 578.83 g/mol. Its IUPAC name is [(8R,19S,20R,23S,24R)-26-[(2R)-2,3-dihydroxypropoxy]-19,20,23,24-tetrahydroxyhexacosan-8-yl] acetate.
| Compound Name | [(8R,19S,20R,23S,24R)-26-[(2R)-2,3-dihydroxypropoxy]-19,20,23,24-tetrahydroxyhexacosan-8-yl] acetate |
|---|---|
| PubChem CID | 132967543 |
| Molecular Formula | C31H62O9 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.44 |
| IUPAC Name | [(8R,19S,20R,23S,24R)-26-[(2R)-2,3-dihydroxypropoxy]-19,20,23,24-tetrahydroxyhexacosan-8-yl] acetate |
| SMILES | CCCCCCC[C@H](CCCCCCCCCC[C@H](O)[C@H](O)CC[C@H](O)[C@H](O)CCOC[C@H](O)CO)OC(C)=O |
| InChI | InChI=1S/C31H62O9/c1-3-4-5-10-13-16-27(40-25(2)33)17-14-11-8-6-7-9-12-15-18-28(35)29(36)19-20-30(37)31(38)21-22-39-24-26(34)23-32/h26-32,34-38H,3-24H2,1-2H3/t26-,27-,28+,29-,30+,31-/m1/s1 |
| InChIKey | RINLGSDNJXEKHK-NDNBUHTASA-N |
| XLogP | 4.16 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|