C44H40N2O8 — CID 132967580
ethyl 4-[5,6,7-tris(4-ethoxycarbonylphenyl)-1-methylindazol-4-yl]benzoate (PubChem CID 132967580) has the molecular formula C44H40N2O8 and a molecular weight of 724.81 g/mol. Its IUPAC name is ethyl 4-[5,6,7-tris(4-ethoxycarbonylphenyl)-1-methylindazol-4-yl]benzoate.
| Compound Name | ethyl 4-[5,6,7-tris(4-ethoxycarbonylphenyl)-1-methylindazol-4-yl]benzoate |
|---|---|
| PubChem CID | 132967580 |
| Molecular Formula | C44H40N2O8 |
| Molecular Weight | 724.81 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | ethyl 4-[5,6,7-tris(4-ethoxycarbonylphenyl)-1-methylindazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c(-c3ccc(C(=O)OCC)cc3)c(-c3ccc(C(=O)OCC)cc3)c3c(cnn3C)c2-c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C44H40N2O8/c1-6-51-41(47)31-18-10-27(11-19-31)36-35-26-45-46(5)40(35)39(30-16-24-34(25-17-30)44(50)54-9-4)38(29-14-22-33(23-15-29)43(49)53-8-3)37(36)28-12-20-32(21-13-28)42(48)52-7-2/h10-26H,6-9H2,1-5H3 |
| InChIKey | KMZSMFZZMAUHGZ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.81 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|