C18H26N2O2S — CID 132967895
3-[(E)-2-methylpent-2-enoyl]-N-(3-tricyclo[3.2.1.02,4]octanyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 132967895) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 3-[(E)-2-methylpent-2-enoyl]-N-(3-tricyclo[3.2.1.02,4]octanyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-[(E)-2-methylpent-2-enoyl]-N-(3-tricyclo[3.2.1.02,4]octanyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 132967895 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 3-[(E)-2-methylpent-2-enoyl]-N-(3-tricyclo[3.2.1.02,4]octanyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC/C=C(\C)C(=O)N1CSCC1C(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C18H26N2O2S/c1-3-4-10(2)18(22)20-9-23-8-13(20)17(21)19-16-14-11-5-6-12(7-11)15(14)16/h4,11-16H,3,5-9H2,1-2H3,(H,19,21)/b10-4+ |
| InChIKey | JVPRCVJPBJTTRM-ONNFQVAWSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|