C14H18O2 — CID 13296809
3,3-dimethyl-2,4,5a,6,7,8-hexahydrodibenzofuran-1-one (PubChem CID 13296809) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3,3-dimethyl-2,4,5a,6,7,8-hexahydrodibenzofuran-1-one.
| Compound Name | 3,3-dimethyl-2,4,5a,6,7,8-hexahydrodibenzofuran-1-one |
|---|---|
| PubChem CID | 13296809 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3,3-dimethyl-2,4,5a,6,7,8-hexahydrodibenzofuran-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1CCCC=C21 |
| InChI | InChI=1S/C14H18O2/c1-14(2)7-10(15)13-9-5-3-4-6-11(9)16-12(13)8-14/h5,11H,3-4,6-8H2,1-2H3 |
| InChIKey | GSKMYPSKDQJZAG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |