C10H10O4 — CID 132969607
4-[(1S,2R,5S,6R)-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]but-3-yn-2-one (PubChem CID 132969607) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-[(1S,2R,5S,6R)-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]but-3-yn-2-one.
| Compound Name | 4-[(1S,2R,5S,6R)-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]but-3-yn-2-one |
|---|---|
| PubChem CID | 132969607 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-[(1S,2R,5S,6R)-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]but-3-yn-2-one |
| SMILES | CC(=O)C#CC1=C[C@H](O)[C@H]2O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C10H10O4/c1-5(11)2-3-6-4-7(12)9-10(14-9)8(6)13/h4,7-10,12-13H,1H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | WAMLPDYUAZSUNU-JLIMGVALSA-N |
| XLogP | -0.99 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|