C11H10FNO2 — CID 132969632
3-[(Z)-2-fluoro-2-phenylethenyl]-1,3-oxazolidin-2-one (PubChem CID 132969632) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 3-[(Z)-2-fluoro-2-phenylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-2-fluoro-2-phenylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132969632 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-[(Z)-2-fluoro-2-phenylethenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1/C=C(\F)c1ccccc1 |
| InChI | InChI=1S/C11H10FNO2/c12-10(9-4-2-1-3-5-9)8-13-6-7-15-11(13)14/h1-5,8H,6-7H2/b10-8- |
| InChIKey | DHTIVSXXPXFDOG-NTMALXAHSA-N |
| XLogP | 2.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |