About 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea
1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea (PubChem CID 132970432) has the molecular formula C9H16F2N2O2
and a molecular weight of 222.23 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea.
Molecular Properties
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea |
| PubChem CID | 132970432 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H16F2N2O2/c10-9(11)3-1-7(2-4-9)13-8(15)12-5-6-14/h7,14H,1-6H2,(H2,12,13,15) |
| InChIKey | OLISEMZLMOLQFB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea?
The IUPAC name of 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea (CID 132970432) is 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea is O=C(NCCO)NC1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea?
The InChIKey is OLISEMZLMOLQFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O2/c10-9(11)3-1-7(2-4-9)13-8(15)12-5-6-14/h7,14H,1-6H2,(H2,12,13,15).
What are the key properties of 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea?
1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea has a molecular weight of 222.23 g/mol, XLogP of 0.86, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)-3-(2-hydroxyethyl)urea is sourced from PubChem (CID 132970432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).