C16H19F2N3O — CID 132970927
1-[(4-cyanophenyl)methyl]-3-(4,4-difluorocyclohexyl)-1-methylurea (PubChem CID 132970927) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-(4,4-difluorocyclohexyl)-1-methylurea.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-(4,4-difluorocyclohexyl)-1-methylurea |
|---|---|
| PubChem CID | 132970927 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-(4,4-difluorocyclohexyl)-1-methylurea |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H19F2N3O/c1-21(11-13-4-2-12(10-19)3-5-13)15(22)20-14-6-8-16(17,18)9-7-14/h2-5,14H,6-9,11H2,1H3,(H,20,22) |
| InChIKey | UXPXHLYCOBNRER-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |