C15H23N7O2 — CID 132971404
3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-N-[3-(triazol-1-yl)propyl]piperidine-1-carboxamide (PubChem CID 132971404) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-N-[3-(triazol-1-yl)propyl]piperidine-1-carboxamide.
| Compound Name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-N-[3-(triazol-1-yl)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 132971404 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-N-[3-(triazol-1-yl)propyl]piperidine-1-carboxamide |
| SMILES | Cc1nc(CC2CCCN(C(=O)NCCCn3ccnn3)C2)no1 |
| InChI | InChI=1S/C15H23N7O2/c1-12-18-14(19-24-12)10-13-4-2-7-21(11-13)15(23)16-5-3-8-22-9-6-17-20-22/h6,9,13H,2-5,7-8,10-11H2,1H3,(H,16,23) |
| InChIKey | LSSJMUFDVWNGEK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|