C17H21N3O4S — CID 132972140
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide (PubChem CID 132972140) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 132972140 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide |
| SMILES | CC(C(=O)N(C)CCc1nccs1)N1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C17H21N3O4S/c1-9(15(21)19(2)7-5-12-18-6-8-25-12)20-16(22)13-10-3-4-11(24-10)14(13)17(20)23/h6,8-11,13-14H,3-5,7H2,1-2H3 |
| InChIKey | WVSGIKWAAMTJHX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|