About 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea
1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea (PubChem CID 132972757) has the molecular formula C22H22ClN3O2
and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea.
Molecular Properties
| Compound Name | 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea |
| PubChem CID | 132972757 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea |
| SMILES | N#Cc1ccc(C2(NC(=O)Nc3cc4c(cc3Cl)CCC4)CCOCC2)cc1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-19-12-16-2-1-3-17(16)13-20(19)25-21(27)26-22(8-10-28-11-9-22)18-6-4-15(14-24)5-7-18/h4-7,12-13H,1-3,8-11H2,(H2,25,26,27) |
| InChIKey | YMPLHYUQVWHLDZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea?
The IUPAC name of 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea (CID 132972757) is 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea.
What is the SMILES notation for 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea?
The canonical SMILES for 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea is N#Cc1ccc(C2(NC(=O)Nc3cc4c(cc3Cl)CCC4)CCOCC2)cc1.
What is the InChIKey of 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea?
The InChIKey is YMPLHYUQVWHLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3O2/c23-19-12-16-2-1-3-17(16)13-20(19)25-21(27)26-22(8-10-28-11-9-22)18-6-4-15(14-24)5-7-18/h4-7,12-13H,1-3,8-11H2,(H2,25,26,27).
What are the key properties of 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea?
1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea has a molecular weight of 395.89 g/mol, XLogP of 4.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-2,3-dihydro-1H-inden-5-yl)-3-[4-(4-cyanophenyl)oxan-4-yl]urea is sourced from PubChem (CID 132972757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).