C26H37N3O4S — CID 132986556
2-[benzyl-[2-(4-ethyl-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide (PubChem CID 132986556) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-ethyl-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide.
| Compound Name | 2-[benzyl-[2-(4-ethyl-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 132986556 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[benzyl-[2-(4-ethyl-N-methylsulfonylanilino)acetyl]amino]-N-(2-methylpropyl)butanamide |
| SMILES | CCc1ccc(N(CC(=O)N(Cc2ccccc2)C(CC)C(=O)NCC(C)C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H37N3O4S/c1-6-21-13-15-23(16-14-21)29(34(5,32)33)19-25(30)28(18-22-11-9-8-10-12-22)24(7-2)26(31)27-17-20(3)4/h8-16,20,24H,6-7,17-19H2,1-5H3,(H,27,31) |
| InChIKey | PNUUPFNCZUUYNX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |