About 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane
2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane (PubChem CID 13298799) has the molecular formula C7H12O4S2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane.
Molecular Properties
| Compound Name | 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane |
| PubChem CID | 13298799 |
| Molecular Formula | C7H12O4S2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane |
| SMILES | C=CC1CC1(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C7H12O4S2/c1-4-6-5-7(6,12(2,8)9)13(3,10)11/h4,6H,1,5H2,2-3H3 |
| InChIKey | IXOSZPSVQRGOGC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane?
The IUPAC name of 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane (CID 13298799) is 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane.
What is the SMILES notation for 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane?
The canonical SMILES for 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane is C=CC1CC1(S(C)(=O)=O)S(C)(=O)=O.
What is the InChIKey of 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane?
The InChIKey is IXOSZPSVQRGOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4S2/c1-4-6-5-7(6,12(2,8)9)13(3,10)11/h4,6H,1,5H2,2-3H3.
What are the key properties of 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane?
2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane has a molecular weight of 224.30 g/mol, XLogP of -0.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1,1-bis(methylsulfonyl)cyclopropane is sourced from PubChem (CID 13298799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).