C18H27N3O3 — CID 132988175
2,4,6-tris(3,4-dihydro-2H-pyran-2-yl)-1,3,5-triazinane (PubChem CID 132988175) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2,4,6-tris(3,4-dihydro-2H-pyran-2-yl)-1,3,5-triazinane.
| Compound Name | 2,4,6-tris(3,4-dihydro-2H-pyran-2-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 132988175 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2,4,6-tris(3,4-dihydro-2H-pyran-2-yl)-1,3,5-triazinane |
| SMILES | C1=COC(C2NC(C3CCC=CO3)NC(C3CCC=CO3)N2)CC1 |
| InChI | InChI=1S/C18H27N3O3/c1-4-10-22-13(7-1)16-19-17(14-8-2-5-11-23-14)21-18(20-16)15-9-3-6-12-24-15/h4-6,10-21H,1-3,7-9H2 |
| InChIKey | LDQSSOXKHWNDPH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |