C19H30N2O4 — CID 132991011
1-[3-(ethoxymethyl)-4-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]phenyl]ethanone (PubChem CID 132991011) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[3-(ethoxymethyl)-4-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]phenyl]ethanone.
| Compound Name | 1-[3-(ethoxymethyl)-4-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 132991011 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-[3-(ethoxymethyl)-4-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]phenyl]ethanone |
| SMILES | CCOCc1cc(C(C)=O)ccc1OCC(O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C19H30N2O4/c1-4-24-13-17-11-16(15(2)22)5-6-19(17)25-14-18(23)12-21-9-7-20(3)8-10-21/h5-6,11,18,23H,4,7-10,12-14H2,1-3H3 |
| InChIKey | AMDBZULEDVHCFP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |