C35H34FNO5Si — CID 132991161
(1S,7S,8R,12S,13R)-1-[tert-butyl(dimethyl)silyl]oxy-13-(4-fluorophenyl)-7,10-diphenyl-4-oxa-10-azatetracyclo[5.5.1.02,6.08,12]tridec-2(6)-ene-3,9,11-trione (PubChem CID 132991161) has the molecular formula C35H34FNO5Si and a molecular weight of 595.74 g/mol. Its IUPAC name is (1S,7S,8R,12S,13R)-1-[tert-butyl(dimethyl)silyl]oxy-13-(4-fluorophenyl)-7,10-diphenyl-4-oxa-10-azatetracyclo[5.5.1.02,6.08,12]tridec-2(6)-ene-3,9,11-trione.
| Compound Name | (1S,7S,8R,12S,13R)-1-[tert-butyl(dimethyl)silyl]oxy-13-(4-fluorophenyl)-7,10-diphenyl-4-oxa-10-azatetracyclo[5.5.1.02,6.08,12]tridec-2(6)-ene-3,9,11-trione |
|---|---|
| PubChem CID | 132991161 |
| Molecular Formula | C35H34FNO5Si |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | (1S,7S,8R,12S,13R)-1-[tert-butyl(dimethyl)silyl]oxy-13-(4-fluorophenyl)-7,10-diphenyl-4-oxa-10-azatetracyclo[5.5.1.02,6.08,12]tridec-2(6)-ene-3,9,11-trione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12C3=C(COC3=O)[C@](c3ccccc3)([C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]31)[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C35H34FNO5Si/c1-33(2,3)43(4,5)42-35-26-25(20-41-32(26)40)34(22-12-8-6-9-13-22,29(35)21-16-18-23(36)19-17-21)27-28(35)31(39)37(30(27)38)24-14-10-7-11-15-24/h6-19,27-29H,20H2,1-5H3/t27-,28+,29+,34+,35+/m0/s1 |
| InChIKey | GHLAKSLMXJBIEJ-JAEHVGOLSA-N |
| XLogP | 6.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|